C20H27BrN2O3S — CID 69330027
4-bromo-N-[(2S,3S)-1-[4-(dimethylamino)phenoxy]-3-methylpentan-2-yl]benzenesulfonamide (PubChem CID 69330027) has the molecular formula C20H27BrN2O3S and a molecular weight of 455.42 g/mol. Its IUPAC name is 4-bromo-N-[(2S,3S)-1-[4-(dimethylamino)phenoxy]-3-methylpentan-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(2S,3S)-1-[4-(dimethylamino)phenoxy]-3-methylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 69330027 |
| Molecular Formula | C20H27BrN2O3S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-bromo-N-[(2S,3S)-1-[4-(dimethylamino)phenoxy]-3-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC[C@H](C)[C@@H](COc1ccc(N(C)C)cc1)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H27BrN2O3S/c1-5-15(2)20(14-26-18-10-8-17(9-11-18)23(3)4)22-27(24,25)19-12-6-16(21)7-13-19/h6-13,15,20,22H,5,14H2,1-4H3/t15-,20+/m0/s1 |
| InChIKey | PQTFWBAHOOJTEL-MGPUTAFESA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|