C28H26FN3O2 — CID 87650536
4-[(6-fluoroquinolin-2-yl)methoxy]-N'-hydroxy-2-(3-methyl-1-phenylcyclobutyl)benzenecarboximidamide (PubChem CID 87650536) has the molecular formula C28H26FN3O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-[(6-fluoroquinolin-2-yl)methoxy]-N'-hydroxy-2-(3-methyl-1-phenylcyclobutyl)benzenecarboximidamide.
| Compound Name | 4-[(6-fluoroquinolin-2-yl)methoxy]-N'-hydroxy-2-(3-methyl-1-phenylcyclobutyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 87650536 |
| Molecular Formula | C28H26FN3O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 4-[(6-fluoroquinolin-2-yl)methoxy]-N'-hydroxy-2-(3-methyl-1-phenylcyclobutyl)benzenecarboximidamide |
| SMILES | CC1CC(c2ccccc2)(c2cc(OCc3ccc4cc(F)ccc4n3)ccc2/C(N)=N/O)C1 |
| InChI | InChI=1S/C28H26FN3O2/c1-18-15-28(16-18,20-5-3-2-4-6-20)25-14-23(10-11-24(25)27(30)32-33)34-17-22-9-7-19-13-21(29)8-12-26(19)31-22/h2-14,18,33H,15-17H2,1H3,(H2,30,32) |
| InChIKey | DAYWQXUYBOMQJW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|