C29H29N3O2 — CID 68896899
2-(3,3-dimethyl-1-phenylcyclobutyl)-4-(quinolin-2-ylmethoxy)benzohydrazide (PubChem CID 68896899) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-(3,3-dimethyl-1-phenylcyclobutyl)-4-(quinolin-2-ylmethoxy)benzohydrazide.
| Compound Name | 2-(3,3-dimethyl-1-phenylcyclobutyl)-4-(quinolin-2-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 68896899 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-(3,3-dimethyl-1-phenylcyclobutyl)-4-(quinolin-2-ylmethoxy)benzohydrazide |
| SMILES | CC1(C)CC(c2ccccc2)(c2cc(OCc3ccc4ccccc4n3)ccc2C(=O)NN)C1 |
| InChI | InChI=1S/C29H29N3O2/c1-28(2)18-29(19-28,21-9-4-3-5-10-21)25-16-23(14-15-24(25)27(33)32-30)34-17-22-13-12-20-8-6-7-11-26(20)31-22/h3-16H,17-19,30H2,1-2H3,(H,32,33) |
| InChIKey | LKQXDZVFYYLYTB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|