C41H54N4O15S2 — CID 87650718
bis[1-[4-[3-(2-methoxyethoxy)-2-methyl-4-methylsulfonylbenzoyl]-1-propylpyrazol-5-yl]oxyethyl] carbonate (PubChem CID 87650718) has the molecular formula C41H54N4O15S2 and a molecular weight of 907.03 g/mol. Its IUPAC name is bis[1-[4-[3-(2-methoxyethoxy)-2-methyl-4-methylsulfonylbenzoyl]-1-propylpyrazol-5-yl]oxyethyl] carbonate.
| Compound Name | bis[1-[4-[3-(2-methoxyethoxy)-2-methyl-4-methylsulfonylbenzoyl]-1-propylpyrazol-5-yl]oxyethyl] carbonate |
|---|---|
| PubChem CID | 87650718 |
| Molecular Formula | C41H54N4O15S2 |
| Molecular Weight | 907.03 g/mol |
| Exact Mass | 906.30 |
| IUPAC Name | bis[1-[4-[3-(2-methoxyethoxy)-2-methyl-4-methylsulfonylbenzoyl]-1-propylpyrazol-5-yl]oxyethyl] carbonate |
| SMILES | CCCn1ncc(C(=O)c2ccc(S(C)(=O)=O)c(OCCOC)c2C)c1OC(C)OC(=O)OC(C)Oc1c(C(=O)c2ccc(S(C)(=O)=O)c(OCCOC)c2C)cnn1CCC |
| InChI | InChI=1S/C41H54N4O15S2/c1-11-17-44-39(31(23-42-44)35(46)29-13-15-33(61(9,49)50)37(25(29)3)55-21-19-53-7)57-27(5)59-41(48)60-28(6)58-40-32(24-43-45(40)18-12-2)36(47)30-14-16-34(62(10,51)52)38(26(30)4)56-22-20-54-8/h13-16,23-24,27-28H,11-12,17-22H2,1-10H3 |
| InChIKey | LODVLBRIXJPLCW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 228.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|