C20H42O2 — CID 87651866
4-methoxy-2,2,4,7,7,9-hexamethyl-9-propan-2-yloxydecane (PubChem CID 87651866) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 4-methoxy-2,2,4,7,7,9-hexamethyl-9-propan-2-yloxydecane.
| Compound Name | 4-methoxy-2,2,4,7,7,9-hexamethyl-9-propan-2-yloxydecane |
|---|---|
| PubChem CID | 87651866 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 4-methoxy-2,2,4,7,7,9-hexamethyl-9-propan-2-yloxydecane |
| SMILES | COC(C)(CCC(C)(C)CC(C)(C)OC(C)C)CC(C)(C)C |
| InChI | InChI=1S/C20H42O2/c1-16(2)22-19(8,9)15-18(6,7)12-13-20(10,21-11)14-17(3,4)5/h16H,12-15H2,1-11H3 |
| InChIKey | QEYPUFIOJZHNPJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |