C21H22ClN6O+ — CID 87652832
3-(3-chlorophenyl)-5-[2-(4,4-diethyl-5-pyridin-4-yl-1,2,4-triazol-4-ium-3-yl)ethyl]-1,2,4-oxadiazole (PubChem CID 87652832) has the molecular formula C21H22ClN6O+ and a molecular weight of 409.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-[2-(4,4-diethyl-5-pyridin-4-yl-1,2,4-triazol-4-ium-3-yl)ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-chlorophenyl)-5-[2-(4,4-diethyl-5-pyridin-4-yl-1,2,4-triazol-4-ium-3-yl)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 87652832 |
| Molecular Formula | C21H22ClN6O+ |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-(3-chlorophenyl)-5-[2-(4,4-diethyl-5-pyridin-4-yl-1,2,4-triazol-4-ium-3-yl)ethyl]-1,2,4-oxadiazole |
| SMILES | CC[N+]1(CC)C(CCc2nc(-c3cccc(Cl)c3)no2)=NN=C1c1ccncc1 |
| InChI | InChI=1S/C21H22ClN6O/c1-3-28(4-2)18(25-26-21(28)15-10-12-23-13-11-15)8-9-19-24-20(27-29-19)16-6-5-7-17(22)14-16/h5-7,10-14H,3-4,8-9H2,1-2H3/q+1 |
| InChIKey | BWJSXCBWXUBXBU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|