C18H17FN2O — CID 87653191
(2S,3S)-2-amino-N-(4-ethynyl-2-fluorophenyl)-3-phenylbutanamide (PubChem CID 87653191) has the molecular formula C18H17FN2O and a molecular weight of 296.35 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-(4-ethynyl-2-fluorophenyl)-3-phenylbutanamide.
| Compound Name | (2S,3S)-2-amino-N-(4-ethynyl-2-fluorophenyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 87653191 |
| Molecular Formula | C18H17FN2O |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S,3S)-2-amino-N-(4-ethynyl-2-fluorophenyl)-3-phenylbutanamide |
| SMILES | C#Cc1ccc(NC(=O)[C@@H](N)[C@@H](C)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C18H17FN2O/c1-3-13-9-10-16(15(19)11-13)21-18(22)17(20)12(2)14-7-5-4-6-8-14/h1,4-12,17H,20H2,2H3,(H,21,22)/t12-,17-/m0/s1 |
| InChIKey | PKLFRWDMKWZQOQ-SJCJKPOMSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|