C25H35N3O10S2 — CID 87654400
[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[2-(methanesulfonamido)ethoxy]phenyl]butan-2-yl]-hydroxycarbamic acid (PubChem CID 87654400) has the molecular formula C25H35N3O10S2 and a molecular weight of 601.70 g/mol. Its IUPAC name is [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[2-(methanesulfonamido)ethoxy]phenyl]butan-2-yl]-hydroxycarbamic acid.
| Compound Name | [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[2-(methanesulfonamido)ethoxy]phenyl]butan-2-yl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 87654400 |
| Molecular Formula | C25H35N3O10S2 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[2-(methanesulfonamido)ethoxy]phenyl]butan-2-yl]-hydroxycarbamic acid |
| SMILES | CC(C)CN(CCC(Cc1ccc(OCCNS(C)(=O)=O)cc1)N(O)C(=O)O)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H35N3O10S2/c1-18(2)16-27(40(34,35)22-8-9-23-24(15-22)38-17-37-23)12-10-20(28(31)25(29)30)14-19-4-6-21(7-5-19)36-13-11-26-39(3,32)33/h4-9,15,18,20,26,31H,10-14,16-17H2,1-3H3,(H,29,30) |
| InChIKey | AULMYDRJBWYLPZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 172.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|