C27H34N4O6S — CID 87655530
[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]-hydroxycarbamic acid (PubChem CID 87655530) has the molecular formula C27H34N4O6S and a molecular weight of 542.66 g/mol. Its IUPAC name is [4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]-hydroxycarbamic acid.
| Compound Name | [4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 87655530 |
| Molecular Formula | C27H34N4O6S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]-hydroxycarbamic acid |
| SMILES | CC(C)CN(CCC(Cc1ccc(OCc2ccccn2)cc1)N(O)C(=O)O)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C27H34N4O6S/c1-20(2)18-30(38(35,36)26-12-8-22(28)9-13-26)16-14-24(31(34)27(32)33)17-21-6-10-25(11-7-21)37-19-23-5-3-4-15-29-23/h3-13,15,20,24,34H,14,16-19,28H2,1-2H3,(H,32,33) |
| InChIKey | WDPRGGGMGUTZJU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|