C35H42N3O8PS — CID 142959609
N-[(3S)-3-amino-4-(4-nitrophenyl)butyl]-4-[bis(phenylmethoxy)phosphorylmethoxy]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 142959609) has the molecular formula C35H42N3O8PS and a molecular weight of 695.78 g/mol. Its IUPAC name is N-[(3S)-3-amino-4-(4-nitrophenyl)butyl]-4-[bis(phenylmethoxy)phosphorylmethoxy]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(3S)-3-amino-4-(4-nitrophenyl)butyl]-4-[bis(phenylmethoxy)phosphorylmethoxy]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 142959609 |
| Molecular Formula | C35H42N3O8PS |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | N-[(3S)-3-amino-4-(4-nitrophenyl)butyl]-4-[bis(phenylmethoxy)phosphorylmethoxy]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC[C@@H](N)Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(OCP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H42N3O8PS/c1-28(2)24-37(22-21-32(36)23-29-13-15-33(16-14-29)38(39)40)48(42,43)35-19-17-34(18-20-35)44-27-47(41,45-25-30-9-5-3-6-10-30)46-26-31-11-7-4-8-12-31/h3-20,28,32H,21-27,36H2,1-2H3/t32-/m1/s1 |
| InChIKey | XJNMABSPVOAAQF-JGCGQSQUSA-N |
| XLogP | 7.16 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|