C32H44N3O9PS — CID 66555840
N-[(2R,3S)-3-[[diethoxyphosphoryl-(4-nitrophenyl)methyl]amino]-2-hydroxy-4-phenylbutyl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 66555840) has the molecular formula C32H44N3O9PS and a molecular weight of 677.76 g/mol. Its IUPAC name is N-[(2R,3S)-3-[[diethoxyphosphoryl-(4-nitrophenyl)methyl]amino]-2-hydroxy-4-phenylbutyl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(2R,3S)-3-[[diethoxyphosphoryl-(4-nitrophenyl)methyl]amino]-2-hydroxy-4-phenylbutyl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66555840 |
| Molecular Formula | C32H44N3O9PS |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.25 |
| IUPAC Name | N-[(2R,3S)-3-[[diethoxyphosphoryl-(4-nitrophenyl)methyl]amino]-2-hydroxy-4-phenylbutyl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(OC)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H44N3O9PS/c1-6-43-45(39,44-7-2)32(26-13-15-27(16-14-26)35(37)38)33-30(21-25-11-9-8-10-12-25)31(36)23-34(22-24(3)4)46(40,41)29-19-17-28(42-5)18-20-29/h8-20,24,30-33,36H,6-7,21-23H2,1-5H3/t30-,31+,32?/m0/s1 |
| InChIKey | ZWBCPEGPEPYRGX-JGIBFQFJSA-N |
| XLogP | 5.78 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|