C24H38N2O3 — CID 87656142
[(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate (PubChem CID 87656142) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate.
| Compound Name | [(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate |
|---|---|
| PubChem CID | 87656142 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | [(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate |
| SMILES | C[C@]12CCC(O/C=N\O[C@@H]3CCNC3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H38N2O3/c1-23-10-7-17(28-15-26-29-18-9-12-25-14-18)13-16(23)3-4-19-20-5-6-22(27)24(20,2)11-8-21(19)23/h15-21,25H,3-14H2,1-2H3/b26-15-/t16?,17?,18-,19+,20+,21+,23+,24+/m1/s1 |
| InChIKey | HSDLAZIKCYBBNG-STXCPFCOSA-N |
| XLogP | 4.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|