C28H42N2O7 — CID 87656141
(E)-but-2-enedioic acid;[(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate (PubChem CID 87656141) has the molecular formula C28H42N2O7 and a molecular weight of 518.65 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate.
| Compound Name | (E)-but-2-enedioic acid;[(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate |
|---|---|
| PubChem CID | 87656141 |
| Molecular Formula | C28H42N2O7 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (E)-but-2-enedioic acid;[(8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] (1Z)-N-[(3R)-pyrrolidin-3-yl]oxymethanimidate |
| SMILES | C[C@]12CCC(O/C=N\O[C@@H]3CCNC3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H38N2O3.C4H4O4/c1-23-10-7-17(28-15-26-29-18-9-12-25-14-18)13-16(23)3-4-19-20-5-6-22(27)24(20,2)11-8-21(19)23;5-3(6)1-2-4(7)8/h15-21,25H,3-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b26-15-;2-1+/t16?,17?,18-,19+,20+,21+,23+,24+;/m1./s1 |
| InChIKey | WKPZLDFVLYLYNP-RIAGOTHMSA-N |
| XLogP | 4.02 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|