C19H15Cl2N3O2 — CID 87657239
(3S,4R)-3-(4-cyanobenzoyl)-4-(3,4-dichlorophenyl)pyrrolidine-3-carboxamide (PubChem CID 87657239) has the molecular formula C19H15Cl2N3O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is (3S,4R)-3-(4-cyanobenzoyl)-4-(3,4-dichlorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-3-(4-cyanobenzoyl)-4-(3,4-dichlorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 87657239 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (3S,4R)-3-(4-cyanobenzoyl)-4-(3,4-dichlorophenyl)pyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccc(C(=O)[C@@]2(C(N)=O)CNC[C@@H]2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c20-15-6-5-13(7-16(15)21)14-9-24-10-19(14,18(23)26)17(25)12-3-1-11(8-22)2-4-12/h1-7,14,24H,9-10H2,(H2,23,26)/t14-,19-/m1/s1 |
| InChIKey | DCJBUAHNSVQTEA-AUUYWEPGSA-N |
| XLogP | 2.91 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|