C23H18N2O3S2 — CID 87658393
N-[(3-phenylmethoxyphenyl)carbamoyl]-N-sulfanyl-1-benzothiophene-2-carboxamide (PubChem CID 87658393) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(3-phenylmethoxyphenyl)carbamoyl]-N-sulfanyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(3-phenylmethoxyphenyl)carbamoyl]-N-sulfanyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 87658393 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[(3-phenylmethoxyphenyl)carbamoyl]-N-sulfanyl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccccc2)c1)N(S)C(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H18N2O3S2/c26-22(21-13-17-9-4-5-12-20(17)30-21)25(29)23(27)24-18-10-6-11-19(14-18)28-15-16-7-2-1-3-8-16/h1-14,29H,15H2,(H,24,27) |
| InChIKey | FOPNXTVYVCSUMX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|