C18H17N3O4 — CID 87659025
3-[1-(5-hydroxy-2-methoxyphenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87659025) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-[1-(5-hydroxy-2-methoxyphenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[1-(5-hydroxy-2-methoxyphenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87659025 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-[1-(5-hydroxy-2-methoxyphenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(O)cc1C(C)Nc1c(Nc2ccncc2)c(=O)c1=O |
| InChI | InChI=1S/C18H17N3O4/c1-10(13-9-12(22)3-4-14(13)25-2)20-15-16(18(24)17(15)23)21-11-5-7-19-8-6-11/h3-10,20,22H,1-2H3,(H,19,21) |
| InChIKey | QTDYYANALTVJCX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|