C11H22O6 — CID 87659385
1-[2,2-bis(2-hydroxypropoxy)ethenoxy]propan-2-ol (PubChem CID 87659385) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-[2,2-bis(2-hydroxypropoxy)ethenoxy]propan-2-ol.
| Compound Name | 1-[2,2-bis(2-hydroxypropoxy)ethenoxy]propan-2-ol |
|---|---|
| PubChem CID | 87659385 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-[2,2-bis(2-hydroxypropoxy)ethenoxy]propan-2-ol |
| SMILES | CC(O)COC=C(OCC(C)O)OCC(C)O |
| InChI | InChI=1S/C11H22O6/c1-8(12)4-15-7-11(16-5-9(2)13)17-6-10(3)14/h7-10,12-14H,4-6H2,1-3H3 |
| InChIKey | BAPLIJWALZTKPJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|