About 2-hydroxypropyl acetate;methoxyperoxymethane
2-hydroxypropyl acetate;methoxyperoxymethane (PubChem CID 87580480) has the molecular formula C7H16O6
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-hydroxypropyl acetate;methoxyperoxymethane.
Molecular Properties
| Compound Name | 2-hydroxypropyl acetate;methoxyperoxymethane |
| PubChem CID | 87580480 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-hydroxypropyl acetate;methoxyperoxymethane |
| SMILES | CC(=O)OCC(C)O.COOOC |
| InChI | InChI=1S/C5H10O3.C2H6O3/c1-4(6)3-8-5(2)7;1-3-5-4-2/h4,6H,3H2,1-2H3;1-2H3 |
| InChIKey | AWSXYGQKMDMBTA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl acetate;methoxyperoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl acetate;methoxyperoxymethane?
The IUPAC name of 2-hydroxypropyl acetate;methoxyperoxymethane (CID 87580480) is 2-hydroxypropyl acetate;methoxyperoxymethane.
What is the SMILES notation for 2-hydroxypropyl acetate;methoxyperoxymethane?
The canonical SMILES for 2-hydroxypropyl acetate;methoxyperoxymethane is CC(=O)OCC(C)O.COOOC.
What is the InChIKey of 2-hydroxypropyl acetate;methoxyperoxymethane?
The InChIKey is AWSXYGQKMDMBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C2H6O3/c1-4(6)3-8-5(2)7;1-3-5-4-2/h4,6H,3H2,1-2H3;1-2H3.
What are the key properties of 2-hydroxypropyl acetate;methoxyperoxymethane?
2-hydroxypropyl acetate;methoxyperoxymethane has a molecular weight of 196.20 g/mol, XLogP of 0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl acetate;methoxyperoxymethane is sourced from PubChem (CID 87580480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).