C12H22O4 — CID 54245312
1-[6-(2-hydroxypropoxy)hexa-1,5-dienoxy]propan-2-ol (PubChem CID 54245312) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-[6-(2-hydroxypropoxy)hexa-1,5-dienoxy]propan-2-ol.
| Compound Name | 1-[6-(2-hydroxypropoxy)hexa-1,5-dienoxy]propan-2-ol |
|---|---|
| PubChem CID | 54245312 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-[6-(2-hydroxypropoxy)hexa-1,5-dienoxy]propan-2-ol |
| SMILES | CC(O)COC=CCCC=COCC(C)O |
| InChI | InChI=1S/C12H22O4/c1-11(13)9-15-7-5-3-4-6-8-16-10-12(2)14/h5-8,11-14H,3-4,9-10H2,1-2H3 |
| InChIKey | QSWMSIFTEZBSPM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|