C7H12N2O2S — CID 87659980
3-cyano-N,N-dimethyl-2-methylsulfinylpropanamide (PubChem CID 87659980) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-cyano-N,N-dimethyl-2-methylsulfinylpropanamide.
| Compound Name | 3-cyano-N,N-dimethyl-2-methylsulfinylpropanamide |
|---|---|
| PubChem CID | 87659980 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-cyano-N,N-dimethyl-2-methylsulfinylpropanamide |
| SMILES | CN(C)C(=O)C(CC#N)S(C)=O |
| InChI | InChI=1S/C7H12N2O2S/c1-9(2)7(10)6(4-5-8)12(3)11/h6H,4H2,1-3H3 |
| InChIKey | YKRXFQRYEGYFIA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |