C17H15NO6 — CID 8766181
1,3-benzodioxol-5-yl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 8766181) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8766181 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)[C@H]1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C17H15NO6/c19-16-6-11(8-18(16)9-13-2-1-5-21-13)17(20)24-12-3-4-14-15(7-12)23-10-22-14/h1-5,7,11H,6,8-10H2/t11-/m0/s1 |
| InChIKey | DCRVLSYLBKLROJ-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|