C26H34N2O4S — CID 87666743
benzyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenyl-1-(sulfanylmethyl)cyclohexyl]carbamate (PubChem CID 87666743) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is benzyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenyl-1-(sulfanylmethyl)cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenyl-1-(sulfanylmethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87666743 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | benzyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenyl-1-(sulfanylmethyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CS)(NC(=O)OCc2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H34N2O4S/c1-25(2,3)32-23(29)27-21-14-15-26(18-33,22(16-21)20-12-8-5-9-13-20)28-24(30)31-17-19-10-6-4-7-11-19/h4-13,21-22,33H,14-18H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | KEBFIFLZSZSRQC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|