C15H20N4O3S — CID 87667733
ethyl 4-[4-oxo-5-[1-(1H-pyrazol-4-yl)ethyl]-2-sulfanylidenepyrimidin-1-yl]butanoate (PubChem CID 87667733) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is ethyl 4-[4-oxo-5-[1-(1H-pyrazol-4-yl)ethyl]-2-sulfanylidenepyrimidin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-oxo-5-[1-(1H-pyrazol-4-yl)ethyl]-2-sulfanylidenepyrimidin-1-yl]butanoate |
|---|---|
| PubChem CID | 87667733 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 4-[4-oxo-5-[1-(1H-pyrazol-4-yl)ethyl]-2-sulfanylidenepyrimidin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(C)c2cn[nH]c2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H20N4O3S/c1-3-22-13(20)5-4-6-19-9-12(14(21)18-15(19)23)10(2)11-7-16-17-8-11/h7-10H,3-6H2,1-2H3,(H,16,17)(H,18,21,23) |
| InChIKey | OCVIVLQMOCLNJX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|