C23H21ClN6O6 — CID 87667891
2-(2-chloro-5-nitrophenyl)-1,3-oxazole;2-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1,3-oxazole (PubChem CID 87667891) has the molecular formula C23H21ClN6O6 and a molecular weight of 512.91 g/mol. Its IUPAC name is 2-(2-chloro-5-nitrophenyl)-1,3-oxazole;2-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1,3-oxazole.
| Compound Name | 2-(2-chloro-5-nitrophenyl)-1,3-oxazole;2-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 87667891 |
| Molecular Formula | C23H21ClN6O6 |
| Molecular Weight | 512.91 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-(2-chloro-5-nitrophenyl)-1,3-oxazole;2-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1,3-oxazole |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2-c2ncco2)CC1.O=[N+]([O-])c1ccc(Cl)c(-c2ncco2)c1 |
| InChI | InChI=1S/C14H16N4O3.C9H5ClN2O3/c1-16-5-7-17(8-6-16)13-3-2-11(18(19)20)10-12(13)14-15-4-9-21-14;10-8-2-1-6(12(13)14)5-7(8)9-11-3-4-15-9/h2-4,9-10H,5-8H2,1H3;1-5H |
| InChIKey | XBTCKPRSJLUZQZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 144.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|