C11H11N2O7PS2 — CID 87668429
(4-nitrophenoxy)-[(thiophen-3-ylsulfonylamino)methyl]phosphinic acid (PubChem CID 87668429) has the molecular formula C11H11N2O7PS2 and a molecular weight of 378.32 g/mol. Its IUPAC name is (4-nitrophenoxy)-[(thiophen-3-ylsulfonylamino)methyl]phosphinic acid.
| Compound Name | (4-nitrophenoxy)-[(thiophen-3-ylsulfonylamino)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87668429 |
| Molecular Formula | C11H11N2O7PS2 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (4-nitrophenoxy)-[(thiophen-3-ylsulfonylamino)methyl]phosphinic acid |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)CNS(=O)(=O)c2ccsc2)cc1 |
| InChI | InChI=1S/C11H11N2O7PS2/c14-13(15)9-1-3-10(4-2-9)20-21(16,17)8-12-23(18,19)11-5-6-22-7-11/h1-7,12H,8H2,(H,16,17) |
| InChIKey | VFAYCKGWNSHXNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|