C40H77N3O4 — CID 87668897
(Z)-18-[2-(2-aminoethylamino)ethyl-[(Z)-17-carboxyheptadec-9-enyl]amino]octadec-9-enoic acid (PubChem CID 87668897) has the molecular formula C40H77N3O4 and a molecular weight of 664.07 g/mol. Its IUPAC name is (Z)-18-[2-(2-aminoethylamino)ethyl-[(Z)-17-carboxyheptadec-9-enyl]amino]octadec-9-enoic acid.
| Compound Name | (Z)-18-[2-(2-aminoethylamino)ethyl-[(Z)-17-carboxyheptadec-9-enyl]amino]octadec-9-enoic acid |
|---|---|
| PubChem CID | 87668897 |
| Molecular Formula | C40H77N3O4 |
| Molecular Weight | 664.07 g/mol |
| Exact Mass | 663.59 |
| IUPAC Name | (Z)-18-[2-(2-aminoethylamino)ethyl-[(Z)-17-carboxyheptadec-9-enyl]amino]octadec-9-enoic acid |
| SMILES | NCCNCCN(CCCCCCCC/C=C\CCCCCCCC(=O)O)CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C40H77N3O4/c41-33-34-42-35-38-43(36-29-25-21-17-13-9-5-1-3-7-11-15-19-23-27-31-39(44)45)37-30-26-22-18-14-10-6-2-4-8-12-16-20-24-28-32-40(46)47/h1-4,42H,5-38,41H2,(H,44,45)(H,46,47)/b3-1-,4-2- |
| InChIKey | ZIHPRLPBXHWRHC-CCAGOZQPSA-N |
| XLogP | 10.04 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.07 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|