C19H25NO2S2 — CID 87669232
2,4,6-trimethyl-N-(1-phenyl-1-sulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 87669232) has the molecular formula C19H25NO2S2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(1-phenyl-1-sulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-(1-phenyl-1-sulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 87669232 |
| Molecular Formula | C19H25NO2S2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2,4,6-trimethyl-N-(1-phenyl-1-sulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1c(C)cc(C)cc1C)C(S)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2S2/c1-5-17(18(23)16-9-7-6-8-10-16)20-24(21,22)19-14(3)11-13(2)12-15(19)4/h6-12,17-18,20,23H,5H2,1-4H3 |
| InChIKey | FHFDKXRXBCLWGM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|