C17H11F7O2 — CID 87669472
1-[4-fluoro-3-(trifluoromethoxy)phenyl]-1-[4-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 87669472) has the molecular formula C17H11F7O2 and a molecular weight of 380.26 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethoxy)phenyl]-1-[4-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-[4-fluoro-3-(trifluoromethoxy)phenyl]-1-[4-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 87669472 |
| Molecular Formula | C17H11F7O2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethoxy)phenyl]-1-[4-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | CC(=O)C(c1ccc(C(F)(F)F)cc1)c1ccc(F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F7O2/c1-9(25)15(10-2-5-12(6-3-10)16(19,20)21)11-4-7-13(18)14(8-11)26-17(22,23)24/h2-8,15H,1H3 |
| InChIKey | MPYULXYWELLXQZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |