C14H12O6 — CID 87670324
[5-[(4-methylphenyl)methoxy]-4-oxopyran-2-yl] hydrogen carbonate (PubChem CID 87670324) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is [5-[(4-methylphenyl)methoxy]-4-oxopyran-2-yl] hydrogen carbonate.
| Compound Name | [5-[(4-methylphenyl)methoxy]-4-oxopyran-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87670324 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [5-[(4-methylphenyl)methoxy]-4-oxopyran-2-yl] hydrogen carbonate |
| SMILES | Cc1ccc(COc2coc(OC(=O)O)cc2=O)cc1 |
| InChI | InChI=1S/C14H12O6/c1-9-2-4-10(5-3-9)7-18-12-8-19-13(6-11(12)15)20-14(16)17/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | HLXBTDCFIVPULP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |