C6H12N4O7Zr — CID 87670454
triamino 2-aminooxypropane-1,2,3-tricarboxylate;zirconium (PubChem CID 87670454) has the molecular formula C6H12N4O7Zr and a molecular weight of 343.41 g/mol. Its IUPAC name is triamino 2-aminooxypropane-1,2,3-tricarboxylate;zirconium.
| Compound Name | triamino 2-aminooxypropane-1,2,3-tricarboxylate;zirconium |
|---|---|
| PubChem CID | 87670454 |
| Molecular Formula | C6H12N4O7Zr |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | triamino 2-aminooxypropane-1,2,3-tricarboxylate;zirconium |
| SMILES | NOC(=O)CC(CC(=O)ON)(ON)C(=O)ON.[Zr] |
| InChI | InChI=1S/C6H12N4O7.Zr/c7-14-3(11)1-6(17-10,5(13)16-9)2-4(12)15-8;/h1-2,7-10H2; |
| InChIKey | YHTDIPSMMRZDEN-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 192.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|