C17H17FN2O2S2 — CID 8767583
ethyl 3-(cyclopropylcarbamothioylamino)-5-(4-fluorophenyl)thiophene-2-carboxylate (PubChem CID 8767583) has the molecular formula C17H17FN2O2S2 and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl 3-(cyclopropylcarbamothioylamino)-5-(4-fluorophenyl)thiophene-2-carboxylate.
| Compound Name | ethyl 3-(cyclopropylcarbamothioylamino)-5-(4-fluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8767583 |
| Molecular Formula | C17H17FN2O2S2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | ethyl 3-(cyclopropylcarbamothioylamino)-5-(4-fluorophenyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(F)cc2)cc1NC(=S)NC1CC1 |
| InChI | InChI=1S/C17H17FN2O2S2/c1-2-22-16(21)15-13(20-17(23)19-12-7-8-12)9-14(24-15)10-3-5-11(18)6-4-10/h3-6,9,12H,2,7-8H2,1H3,(H2,19,20,23) |
| InChIKey | CILGQZQCMGHSHS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|