C5H8N2O4S — CID 87676961
2-[2-(carbamothioylamino)-2-oxoethoxy]acetic acid (PubChem CID 87676961) has the molecular formula C5H8N2O4S and a molecular weight of 192.20 g/mol. Its IUPAC name is 2-[2-(carbamothioylamino)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(carbamothioylamino)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 87676961 |
| Molecular Formula | C5H8N2O4S |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-[2-(carbamothioylamino)-2-oxoethoxy]acetic acid |
| SMILES | NC(=S)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C5H8N2O4S/c6-5(12)7-3(8)1-11-2-4(9)10/h1-2H2,(H,9,10)(H3,6,7,8,12) |
| InChIKey | JMBCSFHTDYPIOX-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|