C10H16N2O10 — CID 87679522
3-(carboxymethoxyamino)-3-[(carboxymethoxyamino)methyl]pentanedioic acid (PubChem CID 87679522) has the molecular formula C10H16N2O10 and a molecular weight of 324.24 g/mol. Its IUPAC name is 3-(carboxymethoxyamino)-3-[(carboxymethoxyamino)methyl]pentanedioic acid.
| Compound Name | 3-(carboxymethoxyamino)-3-[(carboxymethoxyamino)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 87679522 |
| Molecular Formula | C10H16N2O10 |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-(carboxymethoxyamino)-3-[(carboxymethoxyamino)methyl]pentanedioic acid |
| SMILES | O=C(O)CONCC(CC(=O)O)(CC(=O)O)NOCC(=O)O |
| InChI | InChI=1S/C10H16N2O10/c13-6(14)1-10(2-7(15)16,12-22-4-9(19)20)5-11-21-3-8(17)18/h11-12H,1-5H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | MFOFCVDMSZNHCP-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|