About 1-pentoxyprop-2-enyl formate
1-pentoxyprop-2-enyl formate (PubChem CID 87679906) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-pentoxyprop-2-enyl formate.
Molecular Properties
| Compound Name | 1-pentoxyprop-2-enyl formate |
| PubChem CID | 87679906 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1-pentoxyprop-2-enyl formate |
| SMILES | C=CC(OC=O)OCCCCC |
| InChI | InChI=1S/C9H16O3/c1-3-5-6-7-11-9(4-2)12-8-10/h4,8-9H,2-3,5-7H2,1H3 |
| InChIKey | VBGMKZZDRFYXTR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxyprop-2-enyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxyprop-2-enyl formate?
The IUPAC name of 1-pentoxyprop-2-enyl formate (CID 87679906) is 1-pentoxyprop-2-enyl formate.
What is the SMILES notation for 1-pentoxyprop-2-enyl formate?
The canonical SMILES for 1-pentoxyprop-2-enyl formate is C=CC(OC=O)OCCCCC.
What is the InChIKey of 1-pentoxyprop-2-enyl formate?
The InChIKey is VBGMKZZDRFYXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-5-6-7-11-9(4-2)12-8-10/h4,8-9H,2-3,5-7H2,1H3.
What are the key properties of 1-pentoxyprop-2-enyl formate?
1-pentoxyprop-2-enyl formate has a molecular weight of 172.22 g/mol, XLogP of 1.88, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxyprop-2-enyl formate is sourced from PubChem (CID 87679906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).