C9H9NO3 — CID 87679941
2,6-dimethyl-3-(oxomethylidene)-2H-pyridine-5-carboxylic acid (PubChem CID 87679941) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2,6-dimethyl-3-(oxomethylidene)-2H-pyridine-5-carboxylic acid.
| Compound Name | 2,6-dimethyl-3-(oxomethylidene)-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 87679941 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2,6-dimethyl-3-(oxomethylidene)-2H-pyridine-5-carboxylic acid |
| SMILES | CC1=NC(C)C(=C=O)C=C1C(=O)O |
| InChI | InChI=1S/C9H9NO3/c1-5-7(4-11)3-8(9(12)13)6(2)10-5/h3,5H,1-2H3,(H,12,13) |
| InChIKey | TUDLMLOYXAYPCH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|