C9H10N2O2 — CID 144570174
3,4-bis(methylimino)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 144570174) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3,4-bis(methylimino)cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3,4-bis(methylimino)cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 144570174 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3,4-bis(methylimino)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C/N=C1\C=CC(C(=O)O)=C\C1=N/C |
| InChI | InChI=1S/C9H10N2O2/c1-10-7-4-3-6(9(12)13)5-8(7)11-2/h3-5H,1-2H3,(H,12,13)/b10-7+,11-8+ |
| InChIKey | SEAHCLKBISLHHD-AMMQDNIMSA-N |
| XLogP | 0.71 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|