C23H28N4O4S — CID 87687279
[2-[hydroxy-[4-(2-methylpyrazol-3-yl)thiophene-2-carbonyl]amino]-4,4-dimethyl-1-phenylpentan-3-yl]carbamic acid (PubChem CID 87687279) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is [2-[hydroxy-[4-(2-methylpyrazol-3-yl)thiophene-2-carbonyl]amino]-4,4-dimethyl-1-phenylpentan-3-yl]carbamic acid.
| Compound Name | [2-[hydroxy-[4-(2-methylpyrazol-3-yl)thiophene-2-carbonyl]amino]-4,4-dimethyl-1-phenylpentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87687279 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [2-[hydroxy-[4-(2-methylpyrazol-3-yl)thiophene-2-carbonyl]amino]-4,4-dimethyl-1-phenylpentan-3-yl]carbamic acid |
| SMILES | Cn1nccc1-c1csc(C(=O)N(O)C(Cc2ccccc2)C(NC(=O)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H28N4O4S/c1-23(2,3)20(25-22(29)30)18(12-15-8-6-5-7-9-15)27(31)21(28)19-13-16(14-32-19)17-10-11-24-26(17)4/h5-11,13-14,18,20,25,31H,12H2,1-4H3,(H,29,30) |
| InChIKey | BZMGHISOHDCALG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|