C23H27N3O3S — CID 58172915
tert-butyl 4-[[5-(2-methylpyrazol-3-yl)thiophene-3-carbonyl]amino]-4-phenylbutanoate (PubChem CID 58172915) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is tert-butyl 4-[[5-(2-methylpyrazol-3-yl)thiophene-3-carbonyl]amino]-4-phenylbutanoate.
| Compound Name | tert-butyl 4-[[5-(2-methylpyrazol-3-yl)thiophene-3-carbonyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 58172915 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | tert-butyl 4-[[5-(2-methylpyrazol-3-yl)thiophene-3-carbonyl]amino]-4-phenylbutanoate |
| SMILES | Cn1nccc1-c1cc(C(=O)NC(CCC(=O)OC(C)(C)C)c2ccccc2)cs1 |
| InChI | InChI=1S/C23H27N3O3S/c1-23(2,3)29-21(27)11-10-18(16-8-6-5-7-9-16)25-22(28)17-14-20(30-15-17)19-12-13-24-26(19)4/h5-9,12-15,18H,10-11H2,1-4H3,(H,25,28) |
| InChIKey | UEFRTJNEZQLAIO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |