C24H29N5O3 — CID 124886818
tert-butyl N-[(4S)-4-phenyl-4-[(4-pyrazol-1-ylpyridine-2-carbonyl)amino]butyl]carbamate (PubChem CID 124886818) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-phenyl-4-[(4-pyrazol-1-ylpyridine-2-carbonyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-phenyl-4-[(4-pyrazol-1-ylpyridine-2-carbonyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 124886818 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | tert-butyl N-[(4S)-4-phenyl-4-[(4-pyrazol-1-ylpyridine-2-carbonyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)c1cc(-n2cccn2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C24H29N5O3/c1-24(2,3)32-23(31)26-13-7-11-20(18-9-5-4-6-10-18)28-22(30)21-17-19(12-15-25-21)29-16-8-14-27-29/h4-6,8-10,12,14-17,20H,7,11,13H2,1-3H3,(H,26,31)(H,28,30)/t20-/m0/s1 |
| InChIKey | ILVHJACVMHZJET-FQEVSTJZSA-N |
| XLogP | 4.04 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|