C10H22O3Si — CID 87688849
methyl (2S)-4-[hydroxy(dimethyl)silyl]-2,4-dimethylpentanoate (PubChem CID 87688849) has the molecular formula C10H22O3Si and a molecular weight of 218.37 g/mol. Its IUPAC name is methyl (2S)-4-[hydroxy(dimethyl)silyl]-2,4-dimethylpentanoate.
| Compound Name | methyl (2S)-4-[hydroxy(dimethyl)silyl]-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 87688849 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | methyl (2S)-4-[hydroxy(dimethyl)silyl]-2,4-dimethylpentanoate |
| SMILES | COC(=O)[C@@H](C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C10H22O3Si/c1-8(9(11)13-4)7-10(2,3)14(5,6)12/h8,12H,7H2,1-6H3/t8-/m0/s1 |
| InChIKey | MSERNYGJNMDINH-QMMMGPOBSA-N |
| XLogP | 2.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|