C13H24O — CID 87688882
(10E)-trideca-1,10-dien-2-ol (PubChem CID 87688882) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (10E)-trideca-1,10-dien-2-ol.
| Compound Name | (10E)-trideca-1,10-dien-2-ol |
|---|---|
| PubChem CID | 87688882 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (10E)-trideca-1,10-dien-2-ol |
| SMILES | C=C(O)CCCCCCC/C=C/CC |
| InChI | InChI=1S/C13H24O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h4-5,14H,2-3,6-12H2,1H3/b5-4+ |
| InChIKey | MACLAFYLZKYZOL-SNAWJCMRSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|