C10H19O5S+ — CID 87691599
[1-carboxy-2,2-dihydroxy-1-(oxolan-2-yl)propyl]-dimethylsulfanium (PubChem CID 87691599) has the molecular formula C10H19O5S+ and a molecular weight of 251.32 g/mol. Its IUPAC name is [1-carboxy-2,2-dihydroxy-1-(oxolan-2-yl)propyl]-dimethylsulfanium.
| Compound Name | [1-carboxy-2,2-dihydroxy-1-(oxolan-2-yl)propyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 87691599 |
| Molecular Formula | C10H19O5S+ |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [1-carboxy-2,2-dihydroxy-1-(oxolan-2-yl)propyl]-dimethylsulfanium |
| SMILES | C[S+](C)C(C(=O)O)(C1CCCO1)C(C)(O)O |
| InChI | InChI=1S/C10H18O5S/c1-9(13,14)10(8(11)12,16(2)3)7-5-4-6-15-7/h7,13-14H,4-6H2,1-3H3/p+1 |
| InChIKey | NPQKXOHEEZVFBU-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|