C13H24N2O3 — CID 87692073
tert-butyl 6-amino-6-(prop-2-enoylamino)hexanoate (PubChem CID 87692073) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl 6-amino-6-(prop-2-enoylamino)hexanoate.
| Compound Name | tert-butyl 6-amino-6-(prop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 87692073 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl 6-amino-6-(prop-2-enoylamino)hexanoate |
| SMILES | C=CC(=O)NC(N)CCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-5-11(16)15-10(14)8-6-7-9-12(17)18-13(2,3)4/h5,10H,1,6-9,14H2,2-4H3,(H,15,16) |
| InChIKey | KVPCZOQRHOXHPY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|