C17H20ClF6N3O3 — CID 87692796
1-[(5-chloro-2-methoxybenzoyl)-(1,1,1-trifluorobutan-2-yl)amino]-1-(1,1,1-trifluorobutan-2-yl)urea (PubChem CID 87692796) has the molecular formula C17H20ClF6N3O3 and a molecular weight of 463.81 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxybenzoyl)-(1,1,1-trifluorobutan-2-yl)amino]-1-(1,1,1-trifluorobutan-2-yl)urea.
| Compound Name | 1-[(5-chloro-2-methoxybenzoyl)-(1,1,1-trifluorobutan-2-yl)amino]-1-(1,1,1-trifluorobutan-2-yl)urea |
|---|---|
| PubChem CID | 87692796 |
| Molecular Formula | C17H20ClF6N3O3 |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 1-[(5-chloro-2-methoxybenzoyl)-(1,1,1-trifluorobutan-2-yl)amino]-1-(1,1,1-trifluorobutan-2-yl)urea |
| SMILES | CCC(N(C(N)=O)N(C(=O)c1cc(Cl)ccc1OC)C(CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H20ClF6N3O3/c1-4-12(16(19,20)21)26(27(15(25)29)13(5-2)17(22,23)24)14(28)10-8-9(18)6-7-11(10)30-3/h6-8,12-13H,4-5H2,1-3H3,(H2,25,29) |
| InChIKey | MQHZYPGXCFZLIU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|