C24H52N2O — CID 87698192
3-[4-(dimethylamino)decan-3-yloxy]-N,N-dimethyldecan-4-amine (PubChem CID 87698192) has the molecular formula C24H52N2O and a molecular weight of 384.69 g/mol. Its IUPAC name is 3-[4-(dimethylamino)decan-3-yloxy]-N,N-dimethyldecan-4-amine.
| Compound Name | 3-[4-(dimethylamino)decan-3-yloxy]-N,N-dimethyldecan-4-amine |
|---|---|
| PubChem CID | 87698192 |
| Molecular Formula | C24H52N2O |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.41 |
| IUPAC Name | 3-[4-(dimethylamino)decan-3-yloxy]-N,N-dimethyldecan-4-amine |
| SMILES | CCCCCCC(C(CC)OC(CC)C(CCCCCC)N(C)C)N(C)C |
| InChI | InChI=1S/C24H52N2O/c1-9-13-15-17-19-21(25(5)6)23(11-3)27-24(12-4)22(26(7)8)20-18-16-14-10-2/h21-24H,9-20H2,1-8H3 |
| InChIKey | SUTJIEURKPGIHE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|