C22H49NOSi — CID 123751009
N,N,3-trimethyl-2-silyloxynonadecan-4-amine (PubChem CID 123751009) has the molecular formula C22H49NOSi and a molecular weight of 371.73 g/mol. Its IUPAC name is N,N,3-trimethyl-2-silyloxynonadecan-4-amine.
| Compound Name | N,N,3-trimethyl-2-silyloxynonadecan-4-amine |
|---|---|
| PubChem CID | 123751009 |
| Molecular Formula | C22H49NOSi |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | N,N,3-trimethyl-2-silyloxynonadecan-4-amine |
| SMILES | CCCCCCCCCCCCCCCC(C(C)C(C)O[SiH3])N(C)C |
| InChI | InChI=1S/C22H49NOSi/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23(4)5)20(2)21(3)24-25/h20-22H,6-19H2,1-5,25H3 |
| InChIKey | NGRAPHRPNNCRGQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|