About tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate
tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate (PubChem CID 87699008) has the molecular formula C10H19NO6S
and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate.
Analyze tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate?
The IUPAC name of tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate (CID 87699008) is tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate.
What is the SMILES notation for tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate?
The canonical SMILES for tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate is CC(C)(C)OC(=O)ON1C(C)(C)CCOS1(=O)=O.
What is the InChIKey of tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate?
The InChIKey is IMBADIDHSLUECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO6S/c1-9(2,3)16-8(12)17-11-10(4,5)6-7-15-18(11,13)14/h6-7H2,1-5H3.
What are the key properties of tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate?
tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate has a molecular weight of 281.33 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4,4-dimethyl-2,2-dioxooxathiazinan-3-yl) carbonate is sourced from PubChem (CID 87699008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).