C27H46O12 — CID 87703803
(Z)-2-(2,3-dihydroxypropanoyl)octadec-9-enoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87703803) has the molecular formula C27H46O12 and a molecular weight of 562.65 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydroxypropanoyl)octadec-9-enoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (Z)-2-(2,3-dihydroxypropanoyl)octadec-9-enoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87703803 |
| Molecular Formula | C27H46O12 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | (Z)-2-(2,3-dihydroxypropanoyl)octadec-9-enoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C(=O)O)C(=O)C(O)CO.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H38O5.C6H8O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(21(25)26)20(24)19(23)17-22;7-3(8)1-6(13,5(11)12)2-4(9)10/h9-10,18-19,22-23H,2-8,11-17H2,1H3,(H,25,26);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b10-9-; |
| InChIKey | ITHAYLBXFHTCHY-KVVVOXFISA-N |
| XLogP | 3.01 |
| TPSA | 226.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|