C22H20NO8P — CID 87705770
1,2-diphenylethoxy-[(4-nitrophenoxy)carbonyloxymethyl]phosphinic acid (PubChem CID 87705770) has the molecular formula C22H20NO8P and a molecular weight of 457.38 g/mol. Its IUPAC name is 1,2-diphenylethoxy-[(4-nitrophenoxy)carbonyloxymethyl]phosphinic acid.
| Compound Name | 1,2-diphenylethoxy-[(4-nitrophenoxy)carbonyloxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 87705770 |
| Molecular Formula | C22H20NO8P |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 1,2-diphenylethoxy-[(4-nitrophenoxy)carbonyloxymethyl]phosphinic acid |
| SMILES | O=C(OCP(=O)(O)OC(Cc1ccccc1)c1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20NO8P/c24-22(30-20-13-11-19(12-14-20)23(25)26)29-16-32(27,28)31-21(18-9-5-2-6-10-18)15-17-7-3-1-4-8-17/h1-14,21H,15-16H2,(H,27,28) |
| InChIKey | NKSGMTSLNQPGJT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|