C15H24S3 — CID 87707235
2-[[3,5-bis(thiiran-2-ylmethyl)cyclohexyl]methyl]thiirane (PubChem CID 87707235) has the molecular formula C15H24S3 and a molecular weight of 300.56 g/mol. Its IUPAC name is 2-[[3,5-bis(thiiran-2-ylmethyl)cyclohexyl]methyl]thiirane.
| Compound Name | 2-[[3,5-bis(thiiran-2-ylmethyl)cyclohexyl]methyl]thiirane |
|---|---|
| PubChem CID | 87707235 |
| Molecular Formula | C15H24S3 |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[[3,5-bis(thiiran-2-ylmethyl)cyclohexyl]methyl]thiirane |
| SMILES | C1C(CC2CS2)CC(CC2CS2)CC1CC1CS1 |
| InChI | InChI=1S/C15H24S3/c1-10(4-13-7-16-13)2-12(6-15-9-18-15)3-11(1)5-14-8-17-14/h10-15H,1-9H2 |
| InChIKey | UARYDOMNEPFUSJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|